ethyl 2-[2-(phenylmethoxymethyl)tetrazol-5-yl]acetate structure
|
Common Name | ethyl 2-[2-(phenylmethoxymethyl)tetrazol-5-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 88669-78-7 | Molecular Weight | 276.29100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 2-[2-(phenylmethoxymethyl)tetrazol-5-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16N4O3 |
|---|---|
| Molecular Weight | 276.29100 |
| Exact Mass | 276.12200 |
| PSA | 79.13000 |
| LogP | 0.95300 |
| InChIKey | JBXAJDDIPNMWRF-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1nnn(COCc2ccccc2)n1 |
|
~%
ethyl 2-[2-(phe... CAS#:88669-78-7 |
| Literature: Andrus, Alex; Heck, James V.; Christensen, Burton G.; Partridge, Beverly Journal of the American Chemical Society, 1984 , vol. 106, # 6 p. 1808 - 1811 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2H-Tetrazole-5-acetic acid,2-[(phenylmethoxy)methyl]-,ethyl ester |