2-(3-chlorothiophen-2-yl)-3H-benzimidazole-5-carboxylic acid
Modify Date: 2025-10-13 10:52:47
2-(3-chlorothiophen-2-yl)-3H-benzimidazole-5-carboxylic acid structure
|
Common Name | 2-(3-chlorothiophen-2-yl)-3H-benzimidazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 886497-12-7 | Molecular Weight | 278.71400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H7ClN2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(3-chlorothiophen-2-yl)-3H-benzimidazole-5-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H7ClN2O2S |
|---|---|
| Molecular Weight | 278.71400 |
| Exact Mass | 277.99200 |
| PSA | 94.22000 |
| LogP | 3.64300 |
| InChIKey | IDCAWLUVNIVRIO-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc2nc(-c3sccc3Cl)[nH]c2c1 |
|
~%
2-(3-chlorothio... CAS#:886497-12-7 |
| Literature: Viger, Anne; Dervan, Peter B. Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 24 p. 8539 - 8549 |
|
~%
2-(3-chlorothio... CAS#:886497-12-7 |
| Literature: Viger, Anne; Dervan, Peter B. Bioorganic and Medicinal Chemistry, 2006 , vol. 14, # 24 p. 8539 - 8549 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-methoxy-2-{1-methyl-4-[(1-methyl-4-nitro-1H-pyrrole-2-carbonyl)-amino]-1H-imidazol-2-yl}-3H-benzoimidazole-5-carboxylic acid |
| 2-(3-Chloro-thiophen-2-yl)-1H-benzoimidazole-5-carboxylic acid |
| 1H-Benzimidazole-5-carboxylic acid,2-(3-chloro-2-thienyl) |
| 2-(3-Chloro-thiophen-2-yl)-1H-benzoimidazole-5 |