Ethyl 2-pyridin-3-yl-thiazole-5-carboxylate
Modify Date: 2025-09-11 19:54:41
Ethyl 2-pyridin-3-yl-thiazole-5-carboxylate structure
|
Common Name | Ethyl 2-pyridin-3-yl-thiazole-5-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 886370-75-8 | Molecular Weight | 234.27400 | |
| Density | 1.266g/cm3 | Boiling Point | 391ºC at 760 mmHg | |
| Molecular Formula | C11H10N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.3ºC | |
| Name | ethyl 2-pyridin-3-yl-1,3-thiazole-5-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.266g/cm3 |
|---|---|
| Boiling Point | 391ºC at 760 mmHg |
| Molecular Formula | C11H10N2O2S |
| Molecular Weight | 234.27400 |
| Flash Point | 190.3ºC |
| Exact Mass | 234.04600 |
| PSA | 80.32000 |
| LogP | 2.38180 |
| Index of Refraction | 1.582 |
| InChIKey | XKMSDGBXVNMUPM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cnc(-c2cccnc2)s1 |
| HS Code | 2934100090 |
|---|
|
~48%
Ethyl 2-pyridin... CAS#:886370-75-8 |
| Literature: Bayer CropScience AG Patent: US2011/98287 A1, 2011 ; Location in patent: Page/Page column 21 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-PYRIDIN-3-YL-THIAZOLE-5-CARBOXYLIC ACID ETHYL ESTER |
| ethyl 2-pyridin-3-ylthiazole-5-carboxylate |