Diphenhydramine citrate
Modify Date: 2025-08-27 22:42:04
Diphenhydramine citrate structure
|
Common Name | Diphenhydramine citrate | ||
|---|---|---|---|---|
| CAS Number | 88637-37-0 | Molecular Weight | 447.47800 | |
| Density | N/A | Boiling Point | 343.7ºC at 760 mmHg | |
| Molecular Formula | C23H29NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 101.5ºC | |
Use of Diphenhydramine citrateDiphenhydramine Citrate |
| Name | 2-benzhydryloxy-N,N-dimethylethanamine,2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 343.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C23H29NO8 |
| Molecular Weight | 447.47800 |
| Flash Point | 101.5ºC |
| Exact Mass | 447.18900 |
| PSA | 144.60000 |
| LogP | 2.10570 |
| InChIKey | SPCKHVPPRJWQRZ-UHFFFAOYSA-N |
| SMILES | CN(C)CCOC(c1ccccc1)c1ccccc1.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| UNII-4OD433S209 |
| diphenhydramine dihydrogencitrate |
| Diphenhydramine tannate |
| Diphenhydramine laurylsulfate |
| Diphenhydramine citrate |