methyl 2-[(4-methylphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate
Modify Date: 2025-10-02 16:23:37
![methyl 2-[(4-methylphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate Structure](https://image.chemsrc.com/caspic/160/886366-49-0.png)
methyl 2-[(4-methylphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate structure
|
Common Name | methyl 2-[(4-methylphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate | ||
|---|---|---|---|---|
| CAS Number | 886366-49-0 | Molecular Weight | 307.38500 | |
| Density | 1.071g/cm3 | Boiling Point | 432.6ºC at 760 mmHg | |
| Molecular Formula | C17H25NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.4ºC | |
| Name | methyl 2-[(4-methylphenyl)methyl]-3-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.071g/cm3 |
|---|---|
| Boiling Point | 432.6ºC at 760 mmHg |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.38500 |
| Flash Point | 215.4ºC |
| Exact Mass | 307.17800 |
| PSA | 64.63000 |
| LogP | 3.24230 |
| Index of Refraction | 1.502 |
| InChIKey | UKHNGZFSBULVPW-UHFFFAOYSA-N |
| SMILES | COC(=O)C(CNC(=O)OC(C)(C)C)Cc1ccc(C)cc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-[(4-methylphenyl)methyl]-3-[[(2-methylpropan-2-yl)oxy-oxomethyl]amino]propanoic acid methyl ester |
| Methyl 2-N-Boc-2-aminomethyl-3-p-tolyl-propionate |
| Methyl 3-((tert-butoxycarbonyl)amino)-2-(4-methylbenzyl)propanoate |
| 2-(tert-butoxycarbonylamino-methyl)-3-p-tolyl-propionic acid methyl ester |