4,6-Dichloro-2-methyl-1H-indole
Modify Date: 2025-08-25 09:37:36
4,6-Dichloro-2-methyl-1H-indole structure
|
Common Name | 4,6-Dichloro-2-methyl-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 886362-21-6 | Molecular Weight | 200.065 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 336.7±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H7Cl2N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 187.8±12.1 °C | |
| Name | 4,6-dichloro-2-methyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 336.7±37.0 °C at 760 mmHg |
| Molecular Formula | C9H7Cl2N |
| Molecular Weight | 200.065 |
| Flash Point | 187.8±12.1 °C |
| Exact Mass | 198.995560 |
| PSA | 15.79000 |
| LogP | 3.81 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | UCUSJGONHVYQIE-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(Cl)cc(Cl)cc2[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole, 4,6-dichloro-2-methyl- |
| 4,6-Dichloro-2-methylindole |
| 2-Methyl-4,6-dichloro-1H-indole |
| 4,6-Dichloro-2-methyl-1H-indole |