6,8-dibromo-2-ethyl-1H-quinazolin-4-one structure
|
Common Name | 6,8-dibromo-2-ethyl-1H-quinazolin-4-one | ||
|---|---|---|---|---|
| CAS Number | 88624-85-5 | Molecular Weight | 331.99100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Br2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6,8-dibromo-2-ethyl-1H-quinazolin-4-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8Br2N2O |
|---|---|
| Molecular Weight | 331.99100 |
| Exact Mass | 329.90000 |
| PSA | 46.01000 |
| LogP | 3.42280 |
| InChIKey | VWSVQXAIUHXKBR-UHFFFAOYSA-N |
| SMILES | CCc1nc2c(Br)cc(Br)cc2c(=O)[nH]1 |
|
~%
6,8-dibromo-2-e... CAS#:88624-85-5 |
| Literature: Bogert; Hand Journal of the American Chemical Society, 1903 , vol. 25, p. 939 |
|
~%
6,8-dibromo-2-e... CAS#:88624-85-5 |
| Literature: Bogert; Hand Journal of the American Chemical Society, 1903 , vol. 25, p. 939 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-Aethyl-6,8-dibrom-3H-chinazolin-4-on |
| 2-ethyl-6,8-dibromo-3H-quinazolin-4-one |
| 4(1H)-Quinazolinone,6,8-dibromo-2-ethyl |