1,2-Benzisothiazol-3(2H)-one,2-[[bis(2-chloroethyl)amino]methyl]-, 1,1-dioxide structure
|
Common Name | 1,2-Benzisothiazol-3(2H)-one,2-[[bis(2-chloroethyl)amino]methyl]-, 1,1-dioxide | ||
|---|---|---|---|---|
| CAS Number | 88618-36-4 | Molecular Weight | 337.22200 | |
| Density | 1.467g/cm3 | Boiling Point | 428.6ºC at 760 mmHg | |
| Molecular Formula | C12H14Cl2N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213ºC | |
| Name | 2-[bis(2-chloroethyl)aminomethyl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|
| Density | 1.467g/cm3 |
|---|---|
| Boiling Point | 428.6ºC at 760 mmHg |
| Molecular Formula | C12H14Cl2N2O3S |
| Molecular Weight | 337.22200 |
| Flash Point | 213ºC |
| Exact Mass | 336.01000 |
| PSA | 66.07000 |
| LogP | 2.58690 |
| Index of Refraction | 1.602 |
| InChIKey | MLLZJFFQEQCAIG-UHFFFAOYSA-N |
| SMILES | O=C1c2ccccc2S(=O)(=O)N1CN(CCCl)CCCl |
|
~%
1,2-Benzisothia... CAS#:88618-36-4 |
| Literature: Pettit,G.R.; Settepani,J.A. Journal of Organic Chemistry, 1962 , vol. 27, p. 1714 - 1717 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |