4(3H)-Pyrimidinone,6-hydroxy-5-[(3-methylphenyl)amino]-2-(methylthio)-
Modify Date: 2025-08-28 21:06:23
![4(3H)-Pyrimidinone,6-hydroxy-5-[(3-methylphenyl)amino]-2-(methylthio)- Structure](https://image.chemsrc.com/caspic/228/88617-72-5.png)
4(3H)-Pyrimidinone,6-hydroxy-5-[(3-methylphenyl)amino]-2-(methylthio)- structure
|
Common Name | 4(3H)-Pyrimidinone,6-hydroxy-5-[(3-methylphenyl)amino]-2-(methylthio)- | ||
|---|---|---|---|---|
| CAS Number | 88617-72-5 | Molecular Weight | 263.31600 | |
| Density | 1.38g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H13N3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-hydroxy-5-(3-methylanilino)-2-methylsulfanyl-1H-pyrimidin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Molecular Formula | C12H13N3O2S |
| Molecular Weight | 263.31600 |
| Exact Mass | 263.07300 |
| PSA | 103.31000 |
| LogP | 2.32240 |
| Index of Refraction | 1.669 |
| InChIKey | SRRIRLNYDDYHRA-UHFFFAOYSA-N |
| SMILES | CSc1nc(O)c(Nc2cccc(C)c2)c(=O)[nH]1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-m-Toluidino-4,6-dihydroxy-2-methylmercapto-pyrimidin |