2,5-Furandione,dihydro-3-[(4-methoxyphenyl)methyl]- structure
|
Common Name | 2,5-Furandione,dihydro-3-[(4-methoxyphenyl)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 886-30-6 | Molecular Weight | 220.22100 | |
| Density | 1.257g/cm3 | Boiling Point | 394.7ºC at 760 mmHg | |
| Molecular Formula | C12H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.3ºC | |
| Name | 3-[(4-methoxyphenyl)methyl]oxolane-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.257g/cm3 |
|---|---|
| Boiling Point | 394.7ºC at 760 mmHg |
| Molecular Formula | C12H12O4 |
| Molecular Weight | 220.22100 |
| Flash Point | 178.3ºC |
| Exact Mass | 220.07400 |
| PSA | 52.60000 |
| LogP | 1.32740 |
| Index of Refraction | 1.554 |
| InChIKey | FRSALURJHLOYCY-UHFFFAOYSA-N |
| SMILES | COc1ccc(CC2CC(=O)OC2=O)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Succinic anhydride,p-methoxybenzyl |