1-(3-butanoyl-2-hydroxy-5-methylphenyl)butan-1-one
Modify Date: 2025-09-28 10:24:44
1-(3-butanoyl-2-hydroxy-5-methylphenyl)butan-1-one structure
|
Common Name | 1-(3-butanoyl-2-hydroxy-5-methylphenyl)butan-1-one | ||
|---|---|---|---|---|
| CAS Number | 88580-91-0 | Molecular Weight | 248.31700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-butanoyl-2-hydroxy-5-methylphenyl)butan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20O3 |
|---|---|
| Molecular Weight | 248.31700 |
| Exact Mass | 248.14100 |
| PSA | 54.37000 |
| LogP | 3.66620 |
| InChIKey | OEAYBZAZTDUMTB-UHFFFAOYSA-N |
| SMILES | CCCC(=O)c1cc(C)cc(C(=O)CCC)c1O |
|
~%
1-(3-butanoyl-2... CAS#:88580-91-0 |
| Literature: Mandal, Sanat Kumar; Nag, Kamalaksha Journal of the Chemical Society, Dalton Transactions: Inorganic Chemistry (1972-1999), 1983 , p. 2429 - 2434 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-Butanone,1,1'-(2-hydroxy-5-methyl-1,3-phenylene)bis |
| 1,3-dibutyryl-2-hydroxy-5-methylbenzene |