ethyl 4-[(Z)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)prop-1-enyl]benzoate structure
|
Common Name | ethyl 4-[(Z)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)prop-1-enyl]benzoate | ||
|---|---|---|---|---|
| CAS Number | 88579-35-5 | Molecular Weight | 366.51600 | |
| Density | 1.105g/cm3 | Boiling Point | 494.4ºC at 760 mmHg | |
| Molecular Formula | C23H26O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.7ºC | |
| Name | ethyl 4-[(Z)-2-(4,4-dimethyl-2,3-dihydrothiochromen-6-yl)prop-1-enyl]benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.105g/cm3 |
|---|---|
| Boiling Point | 494.4ºC at 760 mmHg |
| Molecular Formula | C23H26O2S |
| Molecular Weight | 366.51600 |
| Flash Point | 236.7ºC |
| Exact Mass | 366.16500 |
| PSA | 51.60000 |
| LogP | 6.19720 |
| Index of Refraction | 1.596 |
| InChIKey | YWQVMUBBTCKAMA-PEZBUJJGSA-N |
| SMILES | CCOC(=O)c1ccc(C=C(C)c2ccc3c(c2)C(C)(C)CCS3)cc1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Edtcpb |
| Ethyl 4-(2-(4,4-dimethylthiochroman-6-yl)propenyl)benzoate |
| Ethyl (E)-p-[2-(4,4-Dimethylthiochroman-6-yl)propenyl]benzoate |
| 4,4-dimethyl-6-[(E)-1-(4-carbethoxyphenyl)-1-propen-2-yl]-3,4-dihydro-2H-1-benzothiopyran |
| ethyl p-[(E)-2-(3,4-dihydro-4,4-dimethyl-2H-1-benzothiopyran-6-yl)propenyl] benzoate |