Imoxiterol
Modify Date: 2025-08-25 12:29:12
Imoxiterol structure
|
Common Name | Imoxiterol | ||
|---|---|---|---|---|
| CAS Number | 88578-07-8 | Molecular Weight | 355.43100 | |
| Density | 1.23g/cm3 | Boiling Point | 590.3ºC at 760 mmHg | |
| Molecular Formula | C20H25N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 310.8ºC | |
Use of ImoxiterolImoxiterol is a β-adrenergic agonist. |
| Name | 4-[2-[4-(benzimidazol-1-yl)butan-2-ylamino]-1-hydroxyethyl]-2-methoxyphenol |
|---|---|
| Synonym | More Synonyms |
| Description | Imoxiterol is a β-adrenergic agonist. |
|---|---|
| Related Catalog | |
| Target |
β-adrenergic |
| Density | 1.23g/cm3 |
|---|---|
| Boiling Point | 590.3ºC at 760 mmHg |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.43100 |
| Flash Point | 310.8ºC |
| Exact Mass | 355.19000 |
| PSA | 79.54000 |
| LogP | 3.24320 |
| Index of Refraction | 1.608 |
| InChIKey | NKKPVWPMPWLEMY-UHFFFAOYSA-N |
| SMILES | COc1cc(C(O)CNC(C)CCn2cnc3ccccc32)ccc1O |
| Storage condition | 2-8℃ |
| Imoxiterol |
| Imoxiterolum [Latin] |
| Imoxiterolum |
| UNII-UR4924C6G2 |