1-(3,4-dimethylphenyl)ethyl 2,3,4,5,6-pentafluorobenzoate structure
|
Common Name | 1-(3,4-dimethylphenyl)ethyl 2,3,4,5,6-pentafluorobenzoate | ||
|---|---|---|---|---|
| CAS Number | 88563-50-2 | Molecular Weight | 344.27600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13F5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3,4-dimethylphenyl)ethyl 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H13F5O2 |
|---|---|
| Molecular Weight | 344.27600 |
| Exact Mass | 344.08400 |
| PSA | 26.30000 |
| LogP | 4.91690 |
| InChIKey | SDAVLMVVYLOHTC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)OC(=O)c2c(F)c(F)c(F)c(F)c2F)cc1C |
|
~%
1-(3,4-dimethyl... CAS#:88563-50-2 |
| Literature: Richard, John P.; Rothenberg, Marc E.; Jencks, William P. Journal of the American Chemical Society, 1984 , vol. 106, # 5 p. 1361 - 1372 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-(3,4-dimethylphenyl)ethyl pentafluorobenzoate |
| Benzoic acid,pentafluoro-,1-(3,4-dimethylphenyl)ethyl ester |