8-chloro-5-(chloromethyl)-2,2-dimethyl-4H-1,3-benzodioxine structure
|
Common Name | 8-chloro-5-(chloromethyl)-2,2-dimethyl-4H-1,3-benzodioxine | ||
|---|---|---|---|---|
| CAS Number | 88557-28-2 | Molecular Weight | 247.11800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12Cl2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-chloro-5-(chloromethyl)-2,2-dimethyl-4H-1,3-benzodioxine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12Cl2O2 |
|---|---|
| Molecular Weight | 247.11800 |
| Exact Mass | 246.02100 |
| PSA | 18.46000 |
| LogP | 3.72390 |
| InChIKey | JHQOJSOOBRDXMZ-UHFFFAOYSA-N |
| SMILES | CC1(C)OCc2c(CCl)ccc(Cl)c2O1 |
|
~%
8-chloro-5-(chl... CAS#:88557-28-2 |
| Literature: Sugiyama; Watanabe; Sassa; Yamashita Agricultural and Biological Chemistry, 1983 , vol. 47, # 10 p. 2411 - 2413 |
|
~%
8-chloro-5-(chl... CAS#:88557-28-2 |
| Literature: Sugiyama; Watanabe; Sassa; Yamashita Agricultural and Biological Chemistry, 1983 , vol. 47, # 10 p. 2411 - 2413 |
|
~%
8-chloro-5-(chl... CAS#:88557-28-2 |
| Literature: Sugiyama; Watanabe; Sassa; Yamashita Agricultural and Biological Chemistry, 1983 , vol. 47, # 10 p. 2411 - 2413 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4H-1,3-Benzodioxin,8-chloro-5-(chloromethyl)-2,2-dimethyl |