Ethyl 4-acetoxy-1H-indole-6-carboxylate
Modify Date: 2025-08-25 16:14:28
Ethyl 4-acetoxy-1H-indole-6-carboxylate structure
|
Common Name | Ethyl 4-acetoxy-1H-indole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 885523-81-9 | Molecular Weight | 247.247 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 429.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C13H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5±24.6 °C | |
| Name | ethyl 4-acetyloxy-1H-indole-6-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 429.3±30.0 °C at 760 mmHg |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.247 |
| Flash Point | 213.5±24.6 °C |
| Exact Mass | 247.084457 |
| PSA | 68.39000 |
| LogP | 2.24 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | XGRHYWCUERDEAB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1cc(OC(C)=O)c2cc[nH]c2c1 |
|
~76%
Ethyl 4-acetoxy... CAS#:885523-81-9 |
| Literature: Kodet, John G.; Wiemer, David F. Journal of Organic Chemistry, 2013 , vol. 78, # 18 p. 9291 - 9302 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-Acetoxy-6-indole carboxylic acid ethyl ester |
| 4-acetoxy-1H-indole-6-carboxylic acid ethyl ester |
| Ethyl 4-acetoxy-1H-indole-6-carboxylate |
| 1H-Indole-6-carboxylic acid, 4-(acetyloxy)-, ethyl ester |