3,6-Dibromo-4-nitro-1H-indazole structure
|
Common Name | 3,6-Dibromo-4-nitro-1H-indazole | ||
|---|---|---|---|---|
| CAS Number | 885519-42-6 | Molecular Weight | 320.926 | |
| Density | 2.3±0.1 g/cm3 | Boiling Point | 471.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H3Br2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.1±27.3 °C | |
| Name | 3,6-dibromo-4-nitro-2H-indazole |
|---|---|
| Synonym | More Synonyms |
| Density | 2.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 471.7±40.0 °C at 760 mmHg |
| Molecular Formula | C7H3Br2N3O2 |
| Molecular Weight | 320.926 |
| Flash Point | 239.1±27.3 °C |
| Exact Mass | 318.859192 |
| PSA | 74.50000 |
| LogP | 3.20 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.782 |
| InChIKey | TZYBWPYNINSHJE-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)cc2n[nH]c(Br)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,6-Dibromo-4-nitro-1H-indazole |
| 1H-Indazole, 3,6-dibromo-4-nitro- |