8-(2-hydroxyethyl)-5,7-dimethyl-2-oxa-8,9-diazabicyclo[4.3.0]nona-4,6,9-trien-3-one structure
|
Common Name | 8-(2-hydroxyethyl)-5,7-dimethyl-2-oxa-8,9-diazabicyclo[4.3.0]nona-4,6,9-trien-3-one | ||
|---|---|---|---|---|
| CAS Number | 88550-08-7 | Molecular Weight | 208.21400 | |
| Density | 1.37g/cm3 | Boiling Point | 430ºC at 760 mmHg | |
| Molecular Formula | C10H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.9ºC | |
| Name | 2-(2-hydroxyethyl)-3,4-dimethylpyrano[2,3-c]pyrazol-6-one |
|---|
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 430ºC at 760 mmHg |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.21400 |
| Flash Point | 213.9ºC |
| Exact Mass | 208.08500 |
| PSA | 68.26000 |
| LogP | 0.59860 |
| Index of Refraction | 1.621 |
| InChIKey | SUGZEVHEIUZQSJ-UHFFFAOYSA-N |
| SMILES | Cc1cc(=O)oc2nn(CCO)c(C)c12 |
|
~%
8-(2-hydroxyeth... CAS#:88550-08-7 |
| Literature: Kuo; Huang; Nakamura Journal of Medicinal Chemistry, 1984 , vol. 27, # 4 p. 539 - 544 |