1-butyl-3,4-dimethylpyrano[2,3-c]pyrazol-6-one structure
|
Common Name | 1-butyl-3,4-dimethylpyrano[2,3-c]pyrazol-6-one | ||
|---|---|---|---|---|
| CAS Number | 88550-01-0 | Molecular Weight | 220.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-butyl-3,4-dimethylpyrano[2,3-c]pyrazol-6-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H16N2O2 |
|---|---|
| Molecular Weight | 220.26800 |
| Exact Mass | 220.12100 |
| PSA | 48.03000 |
| LogP | 2.40640 |
| InChIKey | PTDKNSKUIKBTEY-UHFFFAOYSA-N |
| SMILES | CCCCn1nc(C)c2c(C)cc(=O)oc21 |
|
~%
1-butyl-3,4-dim... CAS#:88550-01-0 |
| Literature: Kuo; Huang; Nakamura Journal of Medicinal Chemistry, 1984 , vol. 27, # 4 p. 539 - 544 |
|
~%
1-butyl-3,4-dim... CAS#:88550-01-0 |
| Literature: Kuo; Huang; Nakamura Journal of Medicinal Chemistry, 1984 , vol. 27, # 4 p. 539 - 544 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Pyrano[2,3-c]pyrazol-6(1H)-one,1-butyl-3,4-dimethyl |