2-(2-nitrophenyl)sulfinylethanol
Modify Date: 2025-08-26 12:20:14
2-(2-nitrophenyl)sulfinylethanol structure
|
Common Name | 2-(2-nitrophenyl)sulfinylethanol | ||
|---|---|---|---|---|
| CAS Number | 88543-37-7 | Molecular Weight | 215.22600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H9NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(2-nitrophenyl)sulfinylethanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H9NO4S |
|---|---|
| Molecular Weight | 215.22600 |
| Exact Mass | 215.02500 |
| PSA | 102.33000 |
| LogP | 2.08360 |
| InChIKey | DIXHUDOVHGPWOG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1S(=O)CCO |
|
~%
2-(2-nitropheny... CAS#:88543-37-7 |
| Literature: Angelini; Grandolini Annali di Chimica (Rome, Italy), 1956 , vol. 46, p. 235,240, 241 |
|
~%
2-(2-nitropheny... CAS#:88543-37-7 |
| Literature: Kent; Smiles Journal of the Chemical Society, 1934 , p. 422,427 |
|
~%
2-(2-nitropheny... CAS#:88543-37-7 |
| Literature: Angelini; Grandolini Annali di Chimica (Rome, Italy), 1956 , vol. 46, p. 235,240, 241 |
![2-[(2-Nitrophenyl)sulfanyl]ethanol structure](https://image.chemsrc.com/caspic/378/13287-78-0.png)
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Ethanol,2-[(2-nitrophenyl)sulfinyl] |
| (+-)-(2-Hydroxy-aethyl)-(2-nitro-phenyl)-sulfoxyd |
| 2-(2-nitro-benzenesulfinyl)-ethanol |
| 2-(2-Nitro-benzolsulfinyl)-aethanol |
| (+-)-1-(2-Nitro-phenylsulfin)-aethanol-(2) |