2-(4-Bromophenyl)-4-chloro-5-methylquinazoline structure
|
Common Name | 2-(4-Bromophenyl)-4-chloro-5-methylquinazoline | ||
|---|---|---|---|---|
| CAS Number | 885277-89-4 | Molecular Weight | 333.610 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 304.7±34.0 °C at 760 mmHg | |
| Molecular Formula | C15H10BrClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138.1±25.7 °C | |
| Name | 2-(4-bromophenyl)-4-chloro-5-methylquinazoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 304.7±34.0 °C at 760 mmHg |
| Molecular Formula | C15H10BrClN2 |
| Molecular Weight | 333.610 |
| Flash Point | 138.1±25.7 °C |
| Exact Mass | 331.971588 |
| PSA | 25.78000 |
| LogP | 5.33 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.672 |
| InChIKey | CWIAZOVNENXTCE-UHFFFAOYSA-N |
| SMILES | Cc1cccc2nc(-c3ccc(Br)cc3)nc(Cl)c12 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(4-BROMO-PHENYL)-4-CHLORO-5-METHYL-QUINAZOLINE |
| Quinazoline, 2-(4-bromophenyl)-4-chloro-5-methyl- |
| 2-(2-CYANO-3-FLUORO)-2-(2-THIENYL)ACETONITRILE |
| Quinazoline,2-(4-bromophenyl)-4-chloro-5-methyl |
| 2-(4-Bromophenyl)-4-chloro-5-methylquinazoline |