1-chloro-4-[(4-chloro-2,5-dimethylphenyl)disulfanyl]-2,5-dimethylbenzene
Modify Date: 2025-11-28 15:25:43
![1-chloro-4-[(4-chloro-2,5-dimethylphenyl)disulfanyl]-2,5-dimethylbenzene Structure](https://image.chemsrc.com/caspic/272/88519-70-4.png)
1-chloro-4-[(4-chloro-2,5-dimethylphenyl)disulfanyl]-2,5-dimethylbenzene structure
|
Common Name | 1-chloro-4-[(4-chloro-2,5-dimethylphenyl)disulfanyl]-2,5-dimethylbenzene | ||
|---|---|---|---|---|
| CAS Number | 88519-70-4 | Molecular Weight | 343.33400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16Cl2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-chloro-4-[(4-chloro-2,5-dimethylphenyl)disulfanyl]-2,5-dimethylbenzene |
|---|
| Molecular Formula | C16H16Cl2S2 |
|---|---|
| Molecular Weight | 343.33400 |
| Exact Mass | 342.00700 |
| PSA | 50.60000 |
| LogP | 7.02640 |
| InChIKey | MAGOCBWXQJWVES-UHFFFAOYSA-N |
| SMILES | Cc1cc(SSc2cc(C)c(Cl)cc2C)c(C)cc1Cl |
|
~%
1-chloro-4-[(4-... CAS#:88519-70-4 |
| Literature: Dosser; Richter Journal of the American Chemical Society, 1934 , vol. 56, p. 1132 |
|
~93%
1-chloro-4-[(4-... CAS#:88519-70-4 |
| Literature: Bauer, Wolfgang Phosphorus, Sulfur and Silicon and the Related Elements, 1994 , vol. 96, # 1-4 p. 493 - 494 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |