2-hex-5-ynyl-6-methyl-5-pent-4-ynyl-1H-pyrimidin-4-one structure
|
Common Name | 2-hex-5-ynyl-6-methyl-5-pent-4-ynyl-1H-pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 88499-84-7 | Molecular Weight | 256.34300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H20N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-hex-5-ynyl-6-methyl-5-pent-4-ynyl-1H-pyrimidin-4-one |
|---|
| Molecular Formula | C16H20N2O |
|---|---|
| Molecular Weight | 256.34300 |
| Exact Mass | 256.15800 |
| PSA | 46.01000 |
| LogP | 2.79250 |
| InChIKey | LVBLYDCUHIYBAS-UHFFFAOYSA-N |
| SMILES | C#CCCCCc1nc(C)c(CCCC#C)c(=O)[nH]1 |
|
~65%
2-hex-5-ynyl-6-... CAS#:88499-84-7 |
| Literature: Rougeot, Etienne; Moskowitz, Henri; Miocque, Marcel Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1407 - 1409 |
|
~%
2-hex-5-ynyl-6-... CAS#:88499-84-7 |
| Literature: Rougeot, Etienne; Moskowitz, Henri; Miocque, Marcel Journal of Heterocyclic Chemistry, 1983 , vol. 20, p. 1407 - 1409 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |