1-phenyl-2-(2,4,6-tribromophenoxy)ethanone structure
|
Common Name | 1-phenyl-2-(2,4,6-tribromophenoxy)ethanone | ||
|---|---|---|---|---|
| CAS Number | 88486-73-1 | Molecular Weight | 448.93200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H9Br3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-phenyl-2-(2,4,6-tribromophenoxy)ethanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H9Br3O2 |
|---|---|
| Molecular Weight | 448.93200 |
| Exact Mass | 445.81500 |
| PSA | 26.30000 |
| LogP | 5.23580 |
| InChIKey | UECIAVXMYDTNRK-UHFFFAOYSA-N |
| SMILES | O=C(COc1c(Br)cc(Br)cc1Br)c1ccccc1 |
|
~50%
1-phenyl-2-(2,4... CAS#:88486-73-1 |
| Literature: Nallu; Selvakumar, Robinson; Pillay, M. Krishna Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 1999 , vol. 38, # 9 p. 1108 - 1110 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| <2,4,6-Tribrom-phenyl>-phenacylether |