(4-bromophenyl)methyl 3-hydroxybenzoate
Modify Date: 2025-10-09 17:38:10
(4-bromophenyl)methyl 3-hydroxybenzoate structure
|
Common Name | (4-bromophenyl)methyl 3-hydroxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 88486-53-7 | Molecular Weight | 307.13900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H11BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-bromophenyl)methyl 3-hydroxybenzoate |
|---|
| Molecular Formula | C14H11BrO3 |
|---|---|
| Molecular Weight | 307.13900 |
| Exact Mass | 305.98900 |
| PSA | 46.53000 |
| LogP | 3.51170 |
| InChIKey | RYJNQCCWVCTPEB-UHFFFAOYSA-N |
| SMILES | O=C(OCc1ccc(Br)cc1)c1cccc(O)c1 |
|
~%
(4-bromophenyl)... CAS#:88486-53-7 |
| Literature: Fiekers; Geronimo Journal of the American Chemical Society, 1948 , vol. 70, p. 1654 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |