2',4'-DICHLORO-3-(1,3-DIOXAN-2-YL)-PROPIOPHENONE structure
|
Common Name | 2',4'-DICHLORO-3-(1,3-DIOXAN-2-YL)-PROPIOPHENONE | ||
|---|---|---|---|---|
| CAS Number | 884504-46-5 | Molecular Weight | 289.15400 | |
| Density | 1.279g/cm3 | Boiling Point | 390ºC at 760 mmHg | |
| Molecular Formula | C13H14Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.6ºC | |
| Name | 1-(2,4-dichlorophenyl)-3-(1,3-dioxan-2-yl)propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.279g/cm3 |
|---|---|
| Boiling Point | 390ºC at 760 mmHg |
| Molecular Formula | C13H14Cl2O3 |
| Molecular Weight | 289.15400 |
| Flash Point | 155.6ºC |
| Exact Mass | 288.03200 |
| PSA | 35.53000 |
| LogP | 3.71930 |
| Index of Refraction | 1.535 |
| InChIKey | MYKSNJIXSWYGFB-UHFFFAOYSA-N |
| SMILES | O=C(CCC1OCCCO1)c1ccc(Cl)cc1Cl |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2',4'-Dichloro-3-(1,3-dioxan-2-yl)propiophenone |