1-(2,2-dichloro-1-fluoroethenyl)-2-(trifluoromethyl)benzene structure
|
Common Name | 1-(2,2-dichloro-1-fluoroethenyl)-2-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 88444-77-3 | Molecular Weight | 259.02800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H4Cl2F4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2,2-dichloro-1-fluoroethenyl)-2-(trifluoromethyl)benzene |
|---|
| Molecular Formula | C9H4Cl2F4 |
|---|---|
| Molecular Weight | 259.02800 |
| Exact Mass | 257.96300 |
| LogP | 4.77860 |
| InChIKey | KODGOBSBXOHULB-UHFFFAOYSA-N |
| SMILES | FC(=C(Cl)Cl)c1ccccc1C(F)(F)F |
|
~76%
1-(2,2-dichloro... CAS#:88444-77-3 |
| Literature: Kodaira, Kazuo; Okuhara, Kunio Bulletin of the Chemical Society of Japan, 1988 , vol. 61, # 5 p. 1625 - 1632 |
|
~%
Detail
|
| Literature: Okuhara, K.; Kodaira, K. Journal of Fluorine Chemistry, 1983 , vol. 23, p. 497 |