3-methyl-2-(2-phenylethenyl)cyclopent-2-en-1-one structure
|
Common Name | 3-methyl-2-(2-phenylethenyl)cyclopent-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 88441-68-3 | Molecular Weight | 198.26000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-methyl-2-(2-phenylethenyl)cyclopent-2-en-1-one |
|---|
| Molecular Formula | C14H14O |
|---|---|
| Molecular Weight | 198.26000 |
| Exact Mass | 198.10400 |
| PSA | 17.07000 |
| LogP | 3.37920 |
| InChIKey | OJCFUKKKFJEHEJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=Cc2ccccc2)C(=O)CC1 |
|
~96%
3-methyl-2-(2-p... CAS#:88441-68-3 |
| Literature: Shimada,J.; Hashimoto,K.; Kim,B.H. Journal of the American Chemical Society, 1984 , vol. 106, p. 1759 |
|
~%
3-methyl-2-(2-p... CAS#:88441-68-3 |
| Literature: Shimada,J.; Hashimoto,K.; Kim,B.H. Journal of the American Chemical Society, 1984 , vol. 106, p. 1759 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |