[1-(1-methoxycyclooctyl)-2-methylidenecyclobutyl]oxy-trimethylsilane structure
|
Common Name | [1-(1-methoxycyclooctyl)-2-methylidenecyclobutyl]oxy-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 88441-53-6 | Molecular Weight | 296.52000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H32O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [1-(1-methoxycyclooctyl)-2-methylidenecyclobutyl]oxy-trimethylsilane |
|---|
| Molecular Formula | C17H32O2Si |
|---|---|
| Molecular Weight | 296.52000 |
| Exact Mass | 296.21700 |
| PSA | 18.46000 |
| LogP | 5.05620 |
| InChIKey | UQVJBVGPAOXYAB-UHFFFAOYSA-N |
| SMILES | C=C1CCC1(O[Si](C)(C)C)C1(OC)CCCCCCC1 |
|
~92%
[1-(1-methoxycy... CAS#:88441-53-6 |
| Literature: Shimada,J.; Hashimoto,K.; Kim,B.H. Journal of the American Chemical Society, 1984 , vol. 106, p. 1759 |
|
~%
[1-(1-methoxycy... CAS#:88441-53-6 |
| Literature: Shimada,J.; Hashimoto,K.; Kim,B.H. Journal of the American Chemical Society, 1984 , vol. 106, p. 1759 |
|
~%
[1-(1-methoxycy... CAS#:88441-53-6 |
| Literature: Shimada,J.; Hashimoto,K.; Kim,B.H. Journal of the American Chemical Society, 1984 , vol. 106, p. 1759 |