Methanesulfonamide, N-(4-(9-acridinylamino)-3-(dimethylamino)phenyl)-
Modify Date: 2025-09-19 15:36:37
Methanesulfonamide, N-(4-(9-acridinylamino)-3-(dimethylamino)phenyl)- structure
|
Common Name | Methanesulfonamide, N-(4-(9-acridinylamino)-3-(dimethylamino)phenyl)- | ||
|---|---|---|---|---|
| CAS Number | 88412-94-6 | Molecular Weight | 406.50100 | |
| Density | 1.376g/cm3 | Boiling Point | 572ºC at 760 mmHg | |
| Molecular Formula | C22H22N4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299.7ºC | |
| Name | N-[4-(acridin-9-ylamino)-3-(dimethylamino)phenyl]methanesulfonamide |
|---|
| Density | 1.376g/cm3 |
|---|---|
| Boiling Point | 572ºC at 760 mmHg |
| Molecular Formula | C22H22N4O2S |
| Molecular Weight | 406.50100 |
| Flash Point | 299.7ºC |
| Exact Mass | 406.14600 |
| PSA | 85.94000 |
| LogP | 5.14480 |
| Index of Refraction | 1.732 |
| InChIKey | JCZWUYIXVYHWDE-UHFFFAOYSA-N |
| SMILES | CN(C)c1cc(NS(C)(=O)=O)ccc1Nc1c2ccccc2nc2ccccc12 |
|
~%
Methanesulfonam... CAS#:88412-94-6 |
| Literature: Atwell, Graham J.; Rewcastle, Gordon W.; Denny, William A.; Cain, Bruce F.; Baguley, Bruce C. Journal of Medicinal Chemistry, 1984 , vol. 27, # 3 p. 367 - 372 |
|
~%
Methanesulfonam... CAS#:88412-94-6 |
| Literature: Atwell, Graham J.; Rewcastle, Gordon W.; Denny, William A.; Cain, Bruce F.; Baguley, Bruce C. Journal of Medicinal Chemistry, 1984 , vol. 27, # 3 p. 367 - 372 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |