N-(3-methyl-4-nitro-thiazol-5-yl)acetamide structure
|
Common Name | N-(3-methyl-4-nitro-thiazol-5-yl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 88394-22-3 | Molecular Weight | 201.20300 | |
| Density | 1.508g/cm3 | Boiling Point | 277.6ºC at 760 mmHg | |
| Molecular Formula | C6H7N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 121.7ºC | |
| Name | 5-acetamido-3-methyl-4-nitroisothiazole |
|---|
| Density | 1.508g/cm3 |
|---|---|
| Boiling Point | 277.6ºC at 760 mmHg |
| Molecular Formula | C6H7N3O3S |
| Molecular Weight | 201.20300 |
| Flash Point | 121.7ºC |
| Exact Mass | 201.02100 |
| PSA | 116.05000 |
| LogP | 1.91430 |
| Index of Refraction | 1.645 |
| InChIKey | OGWKKBVTBYBCOW-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1snc(C)c1[N+](=O)[O-] |
|
~%
N-(3-methyl-4-n... CAS#:88394-22-3 |
| Literature: Adams; Slack Journal of the Chemical Society, 1959 , p. 3061,3065 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |