2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one
Modify Date: 2025-08-29 21:22:35
2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one structure
|
Common Name | 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 883889-80-3 | Molecular Weight | 305.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H19N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C19H19N3O |
|---|---|
| Molecular Weight | 305.4 |
| InChIKey | OJPMWSXHQIEAMR-UHFFFAOYSA-N |
| SMILES | Cn1c(N)nc(CCc2cccc(-c3ccccc3)c2)cc1=O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Inhibition of BACE1 by IGEN assay
Source: ChEMBL
Target: Beta-secretase 1
External Id: CHEMBL901137
|
|
Name: ASTRAZENECA: Octan-1-ol/water (pH7.4) distribution coefficent measured by a shake fl...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3301363
|
|
Name: Inhibition of BACE1 by FRET assay
Source: ChEMBL
Target: Beta-secretase 1
External Id: CHEMBL901135
|
|
Name: Inhibition of human recombinant BACE1 using biotin-XSEVNLDAEFRHDSGC-Eu as substrate a...
Source: ChEMBL
Target: Beta-secretase 1
External Id: CHEMBL2176639
|
|
Name: Inhibition of human BACE1 (43-454 amino acids) expressed in Escherichia coli BL21 usi...
Source: ChEMBL
Target: Beta-secretase 1
External Id: CHEMBL2176640
|
Total 5, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one? |
| A: CAS number of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one is 883889-80-3. |
| Q: What is the English name of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one? |
| A: The English name of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one is 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one. |
| Q: What is the InChIKey of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one? |
| A: InChIKey of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one is OJPMWSXHQIEAMR-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one? |
| A: SMILES notation of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one is Cn1c(N)nc(CCc2cccc(-c3ccccc3)c2)cc1=O. |
| Q: What is the molecular formula of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one? |
| A: Molecular formula of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one is C19H19N3O. |
| Q: What is the Chinese name of 883889-80-3? |
| A: Chinese name of 883889-80-3 is 883889-80-3. |
| Q: What is the molecular weight of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one? |
| A: Molecular weight of 2-amino-6-(2-(biphenyl-3-yl)ethyl)-3-methylpyrimidin-4(3H)-one is 305.4. |