tert-butyl-dimethyl-[(3-methyl-1,4,2-oxathiazolidin-2-yl)oxy]silane
Modify Date: 2024-09-14 17:52:29
![tert-butyl-dimethyl-[(3-methyl-1,4,2-oxathiazolidin-2-yl)oxy]silane Structure](https://image.chemsrc.com/caspic/240/88358-59-2.png)
tert-butyl-dimethyl-[(3-methyl-1,4,2-oxathiazolidin-2-yl)oxy]silane structure
|
Common Name | tert-butyl-dimethyl-[(3-methyl-1,4,2-oxathiazolidin-2-yl)oxy]silane | ||
|---|---|---|---|---|
| CAS Number | 88358-59-2 | Molecular Weight | 235.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H21NO2SSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl-dimethyl-[(3-methyl-1,4,2-oxathiazolidin-2-yl)oxy]silane |
|---|
| Molecular Formula | C9H21NO2SSi |
|---|---|
| Molecular Weight | 235.41900 |
| Exact Mass | 235.10600 |
| PSA | 47.00000 |
| LogP | 3.14500 |
| InChIKey | IRYBBYIUMBZNGC-UHFFFAOYSA-N |
| SMILES | CC1SCON1O[Si](C)(C)C(C)(C)C |
|
~%
tert-butyl-dime... CAS#:88358-59-2 |
| Literature: Vedejs, E.; Perry, D. A.; Houk, K. N.; Rondan, Nelson G. Journal of the American Chemical Society, 1983 , vol. 105, # 23 p. 6999 - 7001 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |