7-(5-chloropentyl)-1,3-dimethylpurine-2,6-dione structure
|
Common Name | 7-(5-chloropentyl)-1,3-dimethylpurine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 88338-99-2 | Molecular Weight | 284.74200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17ClN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7-(5-chloropentyl)-1,3-dimethylpurine-2,6-dione |
|---|
| Molecular Formula | C12H17ClN4O2 |
|---|---|
| Molecular Weight | 284.74200 |
| Exact Mass | 284.10400 |
| PSA | 61.82000 |
| LogP | 0.84280 |
| InChIKey | GZFLHIQBEDOWHS-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2c(ncn2CCCCCCl)n(C)c1=O |
|
~%
7-(5-chloropent... CAS#:88338-99-2 |
| Literature: Parikh; Burger Journal of the American Chemical Society, 1955 , vol. 77, p. 2386 |
|
~%
7-(5-chloropent... CAS#:88338-99-2 |
| Literature: Parikh; Burger Journal of the American Chemical Society, 1955 , vol. 77, p. 2386 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |