[2-[diethyl(methyl)silyl]oxycyclopenten-1-yl]oxy-diethyl-methylsilane structure
|
Common Name | [2-[diethyl(methyl)silyl]oxycyclopenten-1-yl]oxy-diethyl-methylsilane | ||
|---|---|---|---|---|
| CAS Number | 88336-59-8 | Molecular Weight | 300.58400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H32O2Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-[diethyl(methyl)silyl]oxycyclopenten-1-yl]oxy-diethyl-methylsilane |
|---|
| Molecular Formula | C15H32O2Si2 |
|---|---|
| Molecular Weight | 300.58400 |
| Exact Mass | 300.19400 |
| PSA | 18.46000 |
| LogP | 5.64530 |
| InChIKey | XKOJLGYBTCVHEJ-UHFFFAOYSA-N |
| SMILES | CC[Si](C)(CC)OC1=C(O[Si](C)(CC)CC)CCC1 |
|
~95%
[2-[diethyl(met... CAS#:88336-59-8 |
| Literature: Chatani, Naoto; Furukawa, Hidenori; Kato, Toshikazu; Murai, Shinji; Sonoda, Noboru Journal of the American Chemical Society, 1984 , vol. 106, # 2 p. 430 - 432 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |