N-tert-butyl-2-fluoro-4-methylbenzenesulfonamide
Modify Date: 2025-09-12 14:25:53
N-tert-butyl-2-fluoro-4-methylbenzenesulfonamide structure
|
Common Name | N-tert-butyl-2-fluoro-4-methylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 88303-19-9 | Molecular Weight | 245.31400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H16FNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-tert-butyl-2-fluoro-4-methylbenzenesulfonamide |
|---|
| Molecular Formula | C11H16FNO2S |
|---|---|
| Molecular Weight | 245.31400 |
| Exact Mass | 245.08900 |
| PSA | 54.55000 |
| LogP | 3.68260 |
| InChIKey | MNIVNHPFRQXPJP-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)NC(C)(C)C)c(F)c1 |
|
~53%
N-tert-butyl-2-... CAS#:88303-19-9 |
| Literature: E. I. Du Pont de Nemours and Company Patent: US4479901 A1, 1984 ; |
|
~72%
N-tert-butyl-2-... CAS#:88303-19-9 |
| Literature: Hashimoto, Hiromasa; Imamura, Katsuaki; Haruta, Jun-Ichi; Wakitani, Korekiyo Journal of Medicinal Chemistry, 2002 , vol. 45, # 7 p. 1511 - 1517 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |