2,2,3,3,5,5,7,7-octamethyl-1-oxaspiro[3.4]octan-8-one structure
|
Common Name | 2,2,3,3,5,5,7,7-octamethyl-1-oxaspiro[3.4]octan-8-one | ||
|---|---|---|---|---|
| CAS Number | 88292-19-7 | Molecular Weight | 238.36600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,3,3,5,5,7,7-octamethyl-1-oxaspiro[3.4]octan-8-one |
|---|
| Molecular Formula | C15H26O2 |
|---|---|
| Molecular Weight | 238.36600 |
| Exact Mass | 238.19300 |
| PSA | 26.30000 |
| LogP | 3.58540 |
| InChIKey | FRUILENELYYQMG-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(C)(C)C2(OC(C)(C)C2(C)C)C1=O |
|
~0%
Detail
|
| Literature: Verheijdt, Paul L.; Cerfontain, Hans Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1983 , # 9 p. 1343 - 1349 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |