2-azido-5-nitro-N-(4-nitrophenyl)benzamide
Modify Date: 2025-09-12 21:13:21
2-azido-5-nitro-N-(4-nitrophenyl)benzamide structure
|
Common Name | 2-azido-5-nitro-N-(4-nitrophenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 88279-22-5 | Molecular Weight | 328.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8N6O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-azido-5-nitro-N-(4-nitrophenyl)benzamide |
|---|
| Molecular Formula | C13H8N6O5 |
|---|---|
| Molecular Weight | 328.24000 |
| Exact Mass | 328.05600 |
| PSA | 170.49000 |
| LogP | 4.26926 |
| InChIKey | YJKHQEILWWVIJL-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=Nc1ccc([N+](=O)[O-])cc1C(=O)Nc1ccc([N+](=O)[O-])cc1 |
|
~%
2-azido-5-nitro... CAS#:88279-22-5 |
| Literature: Ardakani, Manouchehr Azadi; Smalley, Robert K.; Smith, Richard H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2501 - 2506 |
|
~%
2-azido-5-nitro... CAS#:88279-22-5 |
| Literature: Ardakani, Manouchehr Azadi; Smalley, Robert K.; Smith, Richard H. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2501 - 2506 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
CAS#:88279-21-4