6-methoxy-5-(trifluoromethyl)naphthalene-1-carbaldehyde structure
|
Common Name | 6-methoxy-5-(trifluoromethyl)naphthalene-1-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 88245-15-2 | Molecular Weight | 254.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-methoxy-5-(trifluoromethyl)naphthalene-1-carbaldehyde |
|---|
| Molecular Formula | C13H9F3O2 |
|---|---|
| Molecular Weight | 254.20500 |
| Exact Mass | 254.05500 |
| PSA | 26.30000 |
| LogP | 3.67970 |
| InChIKey | WGPVDRWLOMLILL-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(C=O)cccc2c1C(F)(F)F |
|
~%
6-methoxy-5-(tr... CAS#:88245-15-2 |
| Literature: Sestanj; Bellini; Fung; Abraham; Treasurywala; Humber; Simard-Duquesne; Dvornik Journal of Medicinal Chemistry, 1984 , vol. 27, # 3 p. 255 - 256 |
|
~%
6-methoxy-5-(tr... CAS#:88245-15-2 |
| Literature: Sestanj; Bellini; Fung; Abraham; Treasurywala; Humber; Simard-Duquesne; Dvornik Journal of Medicinal Chemistry, 1984 , vol. 27, # 3 p. 255 - 256 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |