1,3-bis(3-aminophenyl)-1,3-diazinan-2-one structure
|
Common Name | 1,3-bis(3-aminophenyl)-1,3-diazinan-2-one | ||
|---|---|---|---|---|
| CAS Number | 88230-28-8 | Molecular Weight | 282.34000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H18N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(3-aminophenyl)-1,3-diazinan-2-one |
|---|
| Molecular Formula | C16H18N4O |
|---|---|
| Molecular Weight | 282.34000 |
| Exact Mass | 282.14800 |
| PSA | 75.59000 |
| LogP | 3.98010 |
| InChIKey | XOPJQTNNLVCXGE-UHFFFAOYSA-N |
| SMILES | Nc1cccc(N2CCCN(c3cccc(N)c3)C2=O)c1 |
|
~67%
1,3-bis(3-amino... CAS#:88230-28-8 |
| Literature: Nolte,R.J.; Cram,D.J. Journal of the American Chemical Society, 1976 , vol. 106, p. 1416 |
|
~%
1,3-bis(3-amino... CAS#:88230-28-8 |
| Literature: Nolte,R.J.; Cram,D.J. Journal of the American Chemical Society, 1976 , vol. 106, p. 1416 |
|
~%
1,3-bis(3-amino... CAS#:88230-28-8 |
| Literature: Nolte,R.J.; Cram,D.J. Journal of the American Chemical Society, 1976 , vol. 106, p. 1416 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |