N-Allyl-4-nitrobenzamide structure
|
Common Name | N-Allyl-4-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 88229-26-9 | Molecular Weight | 206.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-nitro-N-prop-2-enylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10N2O3 |
|---|---|
| Molecular Weight | 206.19800 |
| Exact Mass | 206.06900 |
| PSA | 74.92000 |
| LogP | 2.42470 |
| InChIKey | FNBFVSBDISVHPT-UHFFFAOYSA-N |
| SMILES | C=CCNC(=O)c1ccc([N+](=O)[O-])cc1 |
|
~99%
N-Allyl-4-nitro... CAS#:88229-26-9 |
| Literature: Agwada Journal of Chemical and Engineering Data, 1984 , vol. 29, # 2 p. 231 - 235 |
|
~%
N-Allyl-4-nitro... CAS#:88229-26-9 |
| Literature: Corey; Guzman-Perez, Angel; Noe, Mark C. Journal of the American Chemical Society, 1995 , vol. 117, # 44 p. 10805 - 10816 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Benzamide,4-nitro-N-2-propenyl |
| N-allyl-4-nitrobenzamide |