2-nitro-N-prop-2-enylbenzamide
Modify Date: 2025-09-06 12:58:33
2-nitro-N-prop-2-enylbenzamide structure
|
Common Name | 2-nitro-N-prop-2-enylbenzamide | ||
|---|---|---|---|---|
| CAS Number | 88229-25-8 | Molecular Weight | 206.19800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-nitro-N-prop-2-enylbenzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10N2O3 |
|---|---|
| Molecular Weight | 206.19800 |
| Exact Mass | 206.06900 |
| PSA | 78.41000 |
| LogP | 2.60860 |
| InChIKey | VXQOIWKQOUDDHZ-UHFFFAOYSA-N |
| SMILES | C=CCNC(=O)c1ccccc1[N+](=O)[O-] |
|
~95%
2-nitro-N-prop-... CAS#:88229-25-8 |
| Literature: Agwada Journal of Chemical and Engineering Data, 1984 , vol. 29, # 2 p. 231 - 235 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzamide,2-nitro-N-2-propenyl |
| 2-nitro-N-prop-2-en-1-ylbenzamide |
| N-allyl-2-nitrobenzamide |