dimethyl 2-methyl-2-(2-phenylmethoxyethyl)propanedioate structure
|
Common Name | dimethyl 2-methyl-2-(2-phenylmethoxyethyl)propanedioate | ||
|---|---|---|---|---|
| CAS Number | 88214-44-2 | Molecular Weight | 280.31600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 2-methyl-2-(2-phenylmethoxyethyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H20O5 |
|---|---|
| Molecular Weight | 280.31600 |
| Exact Mass | 280.13100 |
| PSA | 61.83000 |
| LogP | 1.94560 |
| InChIKey | JEZMBERHTFOKIB-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C)(CCOCc1ccccc1)C(=O)OC |
|
~%
dimethyl 2-meth... CAS#:88214-44-2 |
| Literature: Kocienski, Philip; Todd, Michael Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 8 p. 1783 - 1789 |
| ethyl 4-benzyloxy-2-methoxycarbonyl-2-methylbutanoate |