(1,4,8-trimethoxy-2-methylphenanthren-3-yl)methanol structure
|
Common Name | (1,4,8-trimethoxy-2-methylphenanthren-3-yl)methanol | ||
|---|---|---|---|---|
| CAS Number | 88208-84-8 | Molecular Weight | 312.36000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H20O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (1,4,8-trimethoxy-2-methylphenanthren-3-yl)methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H20O4 |
|---|---|
| Molecular Weight | 312.36000 |
| Exact Mass | 312.13600 |
| PSA | 47.92000 |
| LogP | 3.81950 |
| InChIKey | VBSWTVGTKWLJCF-UHFFFAOYSA-N |
| SMILES | COc1cccc2c1ccc1c(OC)c(C)c(CO)c(OC)c12 |
|
~96%
(1,4,8-trimetho... CAS#:88208-84-8 |
| Literature: Giles, Robin G. F.; Mitchell, Peter R. K.; Sargent, Melvyn V. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , p. 2147 - 2152 |
| 3-Phenanthrenemethanol,1,4,8-trimethoxy-2-methyl |
| 1,4,8-trimethoxy-2-methyl-3-phenanthrylmethanol |