ethyl 3,5-dichloro-2,4-dihydroxy-6-propylbenzoate structure
|
Common Name | ethyl 3,5-dichloro-2,4-dihydroxy-6-propylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 88207-81-2 | Molecular Weight | 293.14300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14Cl2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3,5-dichloro-2,4-dihydroxy-6-propylbenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H14Cl2O4 |
|---|---|
| Molecular Weight | 293.14300 |
| Exact Mass | 292.02700 |
| PSA | 66.76000 |
| LogP | 3.53380 |
| InChIKey | HTNXIMHPSWMGPM-UHFFFAOYSA-N |
| SMILES | CCCc1c(Cl)c(O)c(Cl)c(O)c1C(=O)OCC |
|
~93%
ethyl 3,5-dichl... CAS#:88207-81-2 |
| Literature: Henderson, Graeme B.; Hill, Robert A. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1983 , # 10 p. 2595 - 2599 |
| Benzoic acid,3,5-dichloro-2,4-dihydroxy-6-propyl-,ethyl ester |