2-[[2-(4-methoxyphenyl)-1,3-dithiolan-2-yl]sulfanyl]ethanol structure
|
Common Name | 2-[[2-(4-methoxyphenyl)-1,3-dithiolan-2-yl]sulfanyl]ethanol | ||
|---|---|---|---|---|
| CAS Number | 88180-49-8 | Molecular Weight | 288.44900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H16O2S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[[2-(4-methoxyphenyl)-1,3-dithiolan-2-yl]sulfanyl]ethanol |
|---|
| Molecular Formula | C12H16O2S3 |
|---|---|
| Molecular Weight | 288.44900 |
| Exact Mass | 288.03100 |
| PSA | 105.36000 |
| LogP | 3.01100 |
| InChIKey | CMIURXFPZUXPPS-UHFFFAOYSA-N |
| SMILES | COc1ccc(C2(SCCO)SCCS2)cc1 |
|
~%
2-[[2-(4-methox... CAS#:88180-49-8 |
| Literature: Okuyama, Tadashi; Fujiwara, Wataru; Fueno, Takayuki Journal of the American Chemical Society, 1984 , vol. 106, # 3 p. 657 - 662 |