N-amino-N'-[4-[2-[2-(4-chlorophenyl)-1H-indol-3-yl]hydrazinyl]phenyl]sulfonylmethanimidamide
Modify Date: 2025-09-18 19:30:51
![N-amino-N'-[4-[2-[2-(4-chlorophenyl)-1H-indol-3-yl]hydrazinyl]phenyl]sulfonylmethanimidamide Structure](https://image.chemsrc.com/caspic/159/88152-05-0.png)
N-amino-N'-[4-[2-[2-(4-chlorophenyl)-1H-indol-3-yl]hydrazinyl]phenyl]sulfonylmethanimidamide structure
|
Common Name | N-amino-N'-[4-[2-[2-(4-chlorophenyl)-1H-indol-3-yl]hydrazinyl]phenyl]sulfonylmethanimidamide | ||
|---|---|---|---|---|
| CAS Number | 88152-05-0 | Molecular Weight | 454.93300 | |
| Density | 1.485g/cm3 | Boiling Point | 648.541ºC at 760 mmHg | |
| Molecular Formula | C21H19ClN6O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 346.025ºC | |
| Name | N-amino-N'-[4-[2-[2-(4-chlorophenyl)-1H-indol-3-yl]hydrazinyl]phenyl]sulfonylmethanimidamide |
|---|
| Density | 1.485g/cm3 |
|---|---|
| Boiling Point | 648.541ºC at 760 mmHg |
| Molecular Formula | C21H19ClN6O2S |
| Molecular Weight | 454.93300 |
| Flash Point | 346.025ºC |
| Exact Mass | 454.09800 |
| PSA | 132.78000 |
| LogP | 6.42560 |
| Index of Refraction | 1.718 |
| InChIKey | ZHAUZVBYLADINC-UHFFFAOYSA-N |
| SMILES | NC(N)=NS(=O)(=O)c1ccc(NNc2c(-c3ccc(Cl)cc3)[nH]c3ccccc23)cc1 |
|
~69%
N-amino-N'-[4-[... CAS#:88152-05-0 |
| Literature: Srivastava, Neera; Sengupta, Anil K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 7 p. 707 - 709 |
|
~%
N-amino-N'-[4-[... CAS#:88152-05-0 |
| Literature: Srivastava, Neera; Sengupta, Anil K. Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 7 p. 707 - 709 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |