(4-decylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate
Modify Date: 2025-08-22 20:16:08
(4-decylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate structure
|
Common Name | (4-decylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 88108-23-0 | Molecular Weight | 567.51100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H35BrO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-decylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate |
|---|
| Molecular Formula | C31H35BrO5 |
|---|---|
| Molecular Weight | 567.51100 |
| Exact Mass | 566.16700 |
| PSA | 61.83000 |
| LogP | 8.57930 |
| InChIKey | JIRJDJOVABMHQC-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCCc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(Br)cc3)c(OC)c2)cc1 |
|
~%
(4-decylphenyl)... CAS#:88108-23-0 |
| Literature: Subramanya Raj Urs; Surendranath Molecular crystals and liquid crystals, 1982 , vol. 99, # 1-4 p. 279 - 284 |
|
~%
(4-decylphenyl)... CAS#:88108-23-0 |
| Literature: Subramanya Raj Urs; Surendranath Molecular crystals and liquid crystals, 1982 , vol. 99, # 1-4 p. 279 - 284 |
|
~%
(4-decylphenyl)... CAS#:88108-23-0 |
| Literature: Subramanya Raj Urs; Surendranath Molecular crystals and liquid crystals, 1982 , vol. 99, # 1-4 p. 279 - 284 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |