(4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate
Modify Date: 2025-10-13 09:17:46
(4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate structure
|
Common Name | (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate | ||
|---|---|---|---|---|
| CAS Number | 88108-19-4 | Molecular Weight | 511.40400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H27BrO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-hexylphenyl) 4-(4-bromobenzoyl)oxy-3-methoxybenzoate |
|---|
| Molecular Formula | C27H27BrO5 |
|---|---|
| Molecular Weight | 511.40400 |
| Exact Mass | 510.10400 |
| PSA | 61.83000 |
| LogP | 7.01890 |
| InChIKey | HYVDUEWIGXRHEK-UHFFFAOYSA-N |
| SMILES | CCCCCCc1ccc(OC(=O)c2ccc(OC(=O)c3ccc(Br)cc3)c(OC)c2)cc1 |
|
~%
(4-hexylphenyl)... CAS#:88108-19-4 |
| Literature: Subramanya Raj Urs; Surendranath Molecular crystals and liquid crystals, 1982 , vol. 99, # 1-4 p. 279 - 284 |
|
~%
(4-hexylphenyl)... CAS#:88108-19-4 |
| Literature: Subramanya Raj Urs; Surendranath Molecular crystals and liquid crystals, 1982 , vol. 99, # 1-4 p. 279 - 284 |
|
~%
(4-hexylphenyl)... CAS#:88108-19-4 |
| Literature: Subramanya Raj Urs; Surendranath Molecular crystals and liquid crystals, 1982 , vol. 99, # 1-4 p. 279 - 284 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |