1,3-bis(2,3-dimethylphenyl)thiourea structure
|
Common Name | 1,3-bis(2,3-dimethylphenyl)thiourea | ||
|---|---|---|---|---|
| CAS Number | 88101-26-2 | Molecular Weight | 284.41900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H20N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,3-bis(2,3-dimethylphenyl)thiourea |
|---|
| Molecular Formula | C17H20N2S |
|---|---|
| Molecular Weight | 284.41900 |
| Exact Mass | 284.13500 |
| PSA | 63.19000 |
| LogP | 5.02260 |
| InChIKey | YOPSAQBCRBNECZ-UHFFFAOYSA-N |
| SMILES | Cc1cccc(NC(=S)Nc2cccc(C)c2C)c1C |
|
~71%
1,3-bis(2,3-dim... CAS#:88101-26-2 |
| Literature: Broda, Witold; Dehmlow, Eckehard V. Liebigs Annalen der Chemie, 1983 , # 10 p. 1839 - 1843 |
|
~%
1,3-bis(2,3-dim... CAS#:88101-26-2 |
| Literature: Buu-Hoi et al. Journal of the Chemical Society, 1955 , p. 1581,1583 Errata, 1957 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |